C24H31N3O3 — CID 18346107
(2S)-2-benzamido-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 18346107) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is (2S)-2-benzamido-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | (2S)-2-benzamido-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 18346107 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | (2S)-2-benzamido-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | O=C(N[C@@H](CCCCCCCc1ccc2c(n1)NCCC2)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C24H31N3O3/c28-23(19-10-5-4-6-11-19)27-21(24(29)30)14-8-3-1-2-7-13-20-16-15-18-12-9-17-25-22(18)26-20/h4-6,10-11,15-16,21H,1-3,7-9,12-14,17H2,(H,25,26)(H,27,28)(H,29,30)/t21-/m0/s1 |
| InChIKey | XKMCVGDSJDOSCV-NRFANRHFSA-N |
| XLogP | 4.21 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|