C9H20O3S3 — CID 18346267
2-[2,3-bis(2-sulfanylethoxy)propoxy]ethanethiol (PubChem CID 18346267) has the molecular formula C9H20O3S3 and a molecular weight of 272.46 g/mol. Its IUPAC name is 2-[2,3-bis(2-sulfanylethoxy)propoxy]ethanethiol.
| Compound Name | 2-[2,3-bis(2-sulfanylethoxy)propoxy]ethanethiol |
|---|---|
| PubChem CID | 18346267 |
| Molecular Formula | C9H20O3S3 |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2-[2,3-bis(2-sulfanylethoxy)propoxy]ethanethiol |
| SMILES | SCCOCC(COCCS)OCCS |
| InChI | InChI=1S/C9H20O3S3/c13-4-1-10-7-9(12-3-6-15)8-11-2-5-14/h9,13-15H,1-8H2 |
| InChIKey | UCITWMFXLUEJAL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|