About bis[(2-methylquinolin-8-yl)oxy]gallanyl 2-thiophen-2-ylacetate
bis[(2-methylquinolin-8-yl)oxy]gallanyl 2-thiophen-2-ylacetate (PubChem CID 18346360) has the molecular formula C26H21GaN2O4S
and a molecular weight of 527.25 g/mol. Its IUPAC name is bis[(2-methylquinolin-8-yl)oxy]gallanyl 2-thiophen-2-ylacetate.
Molecular Properties
| Compound Name | bis[(2-methylquinolin-8-yl)oxy]gallanyl 2-thiophen-2-ylacetate |
| PubChem CID | 18346360 |
| Molecular Formula | C26H21GaN2O4S |
| Molecular Weight | 527.25 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | bis[(2-methylquinolin-8-yl)oxy]gallanyl 2-thiophen-2-ylacetate |
| SMILES | Cc1ccc2cccc(O[Ga](OC(=O)Cc3cccs3)Oc3cccc4ccc(C)nc34)c2n1 |
| InChI | InChI=1S/2C10H9NO.C6H6O2S.Ga/c2*1-7-5-6-8-3-2-4-9(12)10(8)11-7;7-6(8)4-5-2-1-3-9-5;/h2*2-6,12H,1H3;1-3H,4H2,(H,7,8);/q;;;+3/p-3 |
| InChIKey | NVRQOCILUVKJCT-UHFFFAOYSA-K |
| XLogP | 5.69 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 527.25 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis[(2-methylquinolin-8-yl)oxy]gallanyl 2-thiophen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(2-methylquinolin-8-yl)oxy]gallanyl 2-thiophen-2-ylacetate?
The IUPAC name of bis[(2-methylquinolin-8-yl)oxy]gallanyl 2-thiophen-2-ylacetate (CID 18346360) is bis[(2-methylquinolin-8-yl)oxy]gallanyl 2-thiophen-2-ylacetate.
What is the SMILES notation for bis[(2-methylquinolin-8-yl)oxy]gallanyl 2-thiophen-2-ylacetate?
The canonical SMILES for bis[(2-methylquinolin-8-yl)oxy]gallanyl 2-thiophen-2-ylacetate is Cc1ccc2cccc(O[Ga](OC(=O)Cc3cccs3)Oc3cccc4ccc(C)nc34)c2n1.
What is the InChIKey of bis[(2-methylquinolin-8-yl)oxy]gallanyl 2-thiophen-2-ylacetate?
The InChIKey is NVRQOCILUVKJCT-UHFFFAOYSA-K. The full InChI is InChI=1S/2C10H9NO.C6H6O2S.Ga/c2*1-7-5-6-8-3-2-4-9(12)10(8)11-7;7-6(8)4-5-2-1-3-9-5;/h2*2-6,12H,1H3;1-3H,4H2,(H,7,8);/q;;;+3/p-3.
What are the key properties of bis[(2-methylquinolin-8-yl)oxy]gallanyl 2-thiophen-2-ylacetate?
bis[(2-methylquinolin-8-yl)oxy]gallanyl 2-thiophen-2-ylacetate has a molecular weight of 527.25 g/mol, XLogP of 5.69, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(2-methylquinolin-8-yl)oxy]gallanyl 2-thiophen-2-ylacetate is sourced from PubChem (CID 18346360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).