C18H15F5O5 — CID 18346499
3-methoxy-4-[4-(2,3,4,5,6-pentafluorophenoxy)butoxy]benzoic acid (PubChem CID 18346499) has the molecular formula C18H15F5O5 and a molecular weight of 406.30 g/mol. Its IUPAC name is 3-methoxy-4-[4-(2,3,4,5,6-pentafluorophenoxy)butoxy]benzoic acid.
| Compound Name | 3-methoxy-4-[4-(2,3,4,5,6-pentafluorophenoxy)butoxy]benzoic acid |
|---|---|
| PubChem CID | 18346499 |
| Molecular Formula | C18H15F5O5 |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 3-methoxy-4-[4-(2,3,4,5,6-pentafluorophenoxy)butoxy]benzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1OCCCCOc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H15F5O5/c1-26-11-8-9(18(24)25)4-5-10(11)27-6-2-3-7-28-17-15(22)13(20)12(19)14(21)16(17)23/h4-5,8H,2-3,6-7H2,1H3,(H,24,25) |
| InChIKey | HKFGZNWZXVKQIT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|