C12H15Cl5O2Si — CID 18346518
trimethyl-[3-(2,3,4,5,6-pentachlorophenoxy)propoxy]silane (PubChem CID 18346518) has the molecular formula C12H15Cl5O2Si and a molecular weight of 396.60 g/mol. Its IUPAC name is trimethyl-[3-(2,3,4,5,6-pentachlorophenoxy)propoxy]silane.
| Compound Name | trimethyl-[3-(2,3,4,5,6-pentachlorophenoxy)propoxy]silane |
|---|---|
| PubChem CID | 18346518 |
| Molecular Formula | C12H15Cl5O2Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 393.93 |
| IUPAC Name | trimethyl-[3-(2,3,4,5,6-pentachlorophenoxy)propoxy]silane |
| SMILES | C[Si](C)(C)OCCCOc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H15Cl5O2Si/c1-20(2,3)19-6-4-5-18-12-10(16)8(14)7(13)9(15)11(12)17/h4-6H2,1-3H3 |
| InChIKey | LAXHJDMCEUWTLM-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|