C21H29F3N4O6S — CID 18346606
(2R)-2-[[formyl(hydroxy)amino]methyl]-N-[(6S)-4-methyl-5-oxo-1-[4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepan-6-yl]hexanamide (PubChem CID 18346606) has the molecular formula C21H29F3N4O6S and a molecular weight of 522.55 g/mol. Its IUPAC name is (2R)-2-[[formyl(hydroxy)amino]methyl]-N-[(6S)-4-methyl-5-oxo-1-[4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepan-6-yl]hexanamide.
| Compound Name | (2R)-2-[[formyl(hydroxy)amino]methyl]-N-[(6S)-4-methyl-5-oxo-1-[4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepan-6-yl]hexanamide |
|---|---|
| PubChem CID | 18346606 |
| Molecular Formula | C21H29F3N4O6S |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | (2R)-2-[[formyl(hydroxy)amino]methyl]-N-[(6S)-4-methyl-5-oxo-1-[4-(trifluoromethyl)phenyl]sulfonyl-1,4-diazepan-6-yl]hexanamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)N[C@H]1CN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CCN(C)C1=O |
| InChI | InChI=1S/C21H29F3N4O6S/c1-3-4-5-15(12-27(32)14-29)19(30)25-18-13-28(11-10-26(2)20(18)31)35(33,34)17-8-6-16(7-9-17)21(22,23)24/h6-9,14-15,18,32H,3-5,10-13H2,1-2H3,(H,25,30)/t15-,18+/m1/s1 |
| InChIKey | FZBWOKTXCWGUEN-QAPCUYQASA-N |
| XLogP | 1.31 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|