About 1-adamantylhydrazine;dichloroplatinum
1-adamantylhydrazine;dichloroplatinum (PubChem CID 18346919) has the molecular formula C10H18Cl2N2Pt
and a molecular weight of 432.25 g/mol. Its IUPAC name is 1-adamantylhydrazine;dichloroplatinum.
Molecular Properties
| Compound Name | 1-adamantylhydrazine;dichloroplatinum |
| PubChem CID | 18346919 |
| Molecular Formula | C10H18Cl2N2Pt |
| Molecular Weight | 432.25 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 1-adamantylhydrazine;dichloroplatinum |
| SMILES | Cl[Pt]Cl.NNC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H18N2.2ClH.Pt/c11-12-10-4-7-1-8(5-10)3-9(2-7)6-10;;;/h7-9,12H,1-6,11H2;2*1H;/q;;;+2/p-2 |
| InChIKey | ZYMSOYKEQURNPO-UHFFFAOYSA-L |
| XLogP | 2.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantylhydrazine;dichloroplatinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantylhydrazine;dichloroplatinum?
The IUPAC name of 1-adamantylhydrazine;dichloroplatinum (CID 18346919) is 1-adamantylhydrazine;dichloroplatinum.
What is the SMILES notation for 1-adamantylhydrazine;dichloroplatinum?
The canonical SMILES for 1-adamantylhydrazine;dichloroplatinum is Cl[Pt]Cl.NNC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantylhydrazine;dichloroplatinum?
The InChIKey is ZYMSOYKEQURNPO-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H18N2.2ClH.Pt/c11-12-10-4-7-1-8(5-10)3-9(2-7)6-10;;;/h7-9,12H,1-6,11H2;2*1H;/q;;;+2/p-2.
What are the key properties of 1-adamantylhydrazine;dichloroplatinum?
1-adamantylhydrazine;dichloroplatinum has a molecular weight of 432.25 g/mol, XLogP of 2.80, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantylhydrazine;dichloroplatinum is sourced from PubChem (CID 18346919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).