C23H24F2N2O2 — CID 18347046
3-[[1-(3,4-difluorophenyl)ethylamino]-(4-methoxyphenyl)methyl]-4-methoxyaniline (PubChem CID 18347046) has the molecular formula C23H24F2N2O2 and a molecular weight of 398.45 g/mol. Its IUPAC name is 3-[[1-(3,4-difluorophenyl)ethylamino]-(4-methoxyphenyl)methyl]-4-methoxyaniline.
| Compound Name | 3-[[1-(3,4-difluorophenyl)ethylamino]-(4-methoxyphenyl)methyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 18347046 |
| Molecular Formula | C23H24F2N2O2 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 3-[[1-(3,4-difluorophenyl)ethylamino]-(4-methoxyphenyl)methyl]-4-methoxyaniline |
| SMILES | COc1ccc(C(NC(C)c2ccc(F)c(F)c2)c2cc(N)ccc2OC)cc1 |
| InChI | InChI=1S/C23H24F2N2O2/c1-14(16-6-10-20(24)21(25)12-16)27-23(15-4-8-18(28-2)9-5-15)19-13-17(26)7-11-22(19)29-3/h4-14,23,27H,26H2,1-3H3 |
| InChIKey | UFTUFBJTTSKKRM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|