About chloro-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane
chloro-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane (PubChem CID 18347404) has the molecular formula C19H31ClOSi
and a molecular weight of 339.00 g/mol. Its IUPAC name is chloro-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane.
Molecular Properties
| Compound Name | chloro-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane |
| PubChem CID | 18347404 |
| Molecular Formula | C19H31ClOSi |
| Molecular Weight | 339.00 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | chloro-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane |
| SMILES | C=CCOc1c(C(C)(C)C)cc(C(C)(C)C)cc1[Si](C)(C)Cl |
| InChI | InChI=1S/C19H31ClOSi/c1-10-11-21-17-15(19(5,6)7)12-14(18(2,3)4)13-16(17)22(8,9)20/h10,12-13H,1,11H2,2-9H3 |
| InChIKey | RZSDGEZLTRZGEN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.00 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane?
The IUPAC name of chloro-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane (CID 18347404) is chloro-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane.
What is the SMILES notation for chloro-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane?
The canonical SMILES for chloro-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane is C=CCOc1c(C(C)(C)C)cc(C(C)(C)C)cc1[Si](C)(C)Cl.
What is the InChIKey of chloro-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane?
The InChIKey is RZSDGEZLTRZGEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31ClOSi/c1-10-11-21-17-15(19(5,6)7)12-14(18(2,3)4)13-16(17)22(8,9)20/h10,12-13H,1,11H2,2-9H3.
What are the key properties of chloro-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane?
chloro-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane has a molecular weight of 339.00 g/mol, XLogP of 5.50, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-(3,5-ditert-butyl-2-prop-2-enoxyphenyl)-dimethylsilane is sourced from PubChem (CID 18347404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).