About lithium 1,2,3-trimethylcyclopenta-1,3-diene
lithium 1,2,3-trimethylcyclopenta-1,3-diene (PubChem CID 18347737) has the molecular formula C8H11Li
and a molecular weight of 114.12 g/mol. Its IUPAC name is lithium 1,2,3-trimethylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | lithium 1,2,3-trimethylcyclopenta-1,3-diene |
| PubChem CID | 18347737 |
| Molecular Formula | C8H11Li |
| Molecular Weight | 114.12 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | lithium 1,2,3-trimethylcyclopenta-1,3-diene |
| SMILES | CC1=[C-]CC(C)=C1C.[Li+] |
| InChI | InChI=1S/C8H11.Li/c1-6-4-5-7(2)8(6)3;/h4H2,1-3H3;/q-1;+1 |
| InChIKey | WHOLSYBRACDISE-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.12 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium 1,2,3-trimethylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 1,2,3-trimethylcyclopenta-1,3-diene?
The IUPAC name of lithium 1,2,3-trimethylcyclopenta-1,3-diene (CID 18347737) is lithium 1,2,3-trimethylcyclopenta-1,3-diene.
What is the SMILES notation for lithium 1,2,3-trimethylcyclopenta-1,3-diene?
The canonical SMILES for lithium 1,2,3-trimethylcyclopenta-1,3-diene is CC1=[C-]CC(C)=C1C.[Li+].
What is the InChIKey of lithium 1,2,3-trimethylcyclopenta-1,3-diene?
The InChIKey is WHOLSYBRACDISE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11.Li/c1-6-4-5-7(2)8(6)3;/h4H2,1-3H3;/q-1;+1.
What are the key properties of lithium 1,2,3-trimethylcyclopenta-1,3-diene?
lithium 1,2,3-trimethylcyclopenta-1,3-diene has a molecular weight of 114.12 g/mol, XLogP of -0.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 1,2,3-trimethylcyclopenta-1,3-diene is sourced from PubChem (CID 18347737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).