C9H8F6O5 — CID 18348210
[2-oxo-1-(2,2,2-trifluoroacetyl)oxypentyl] 2,2,2-trifluoroacetate (PubChem CID 18348210) has the molecular formula C9H8F6O5 and a molecular weight of 310.15 g/mol. Its IUPAC name is [2-oxo-1-(2,2,2-trifluoroacetyl)oxypentyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-oxo-1-(2,2,2-trifluoroacetyl)oxypentyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 18348210 |
| Molecular Formula | C9H8F6O5 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | [2-oxo-1-(2,2,2-trifluoroacetyl)oxypentyl] 2,2,2-trifluoroacetate |
| SMILES | CCCC(=O)C(OC(=O)C(F)(F)F)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H8F6O5/c1-2-3-4(16)5(19-6(17)8(10,11)12)20-7(18)9(13,14)15/h5H,2-3H2,1H3 |
| InChIKey | NGUIZBYMPFBLMZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|