About 4-amino-1-(1,5-dihydroxy-4-methylpentyl)pyrimidin-2-one
4-amino-1-(1,5-dihydroxy-4-methylpentyl)pyrimidin-2-one (PubChem CID 18348321) has the molecular formula C10H17N3O3
and a molecular weight of 227.26 g/mol. Its IUPAC name is 4-amino-1-(1,5-dihydroxy-4-methylpentyl)pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-amino-1-(1,5-dihydroxy-4-methylpentyl)pyrimidin-2-one |
| PubChem CID | 18348321 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 4-amino-1-(1,5-dihydroxy-4-methylpentyl)pyrimidin-2-one |
| SMILES | CC(CO)CCC(O)n1ccc(N)nc1=O |
| InChI | InChI=1S/C10H17N3O3/c1-7(6-14)2-3-9(15)13-5-4-8(11)12-10(13)16/h4-5,7,9,14-15H,2-3,6H2,1H3,(H2,11,12,16) |
| InChIKey | JWSCAKDDIKYXHM-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-1-(1,5-dihydroxy-4-methylpentyl)pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-(1,5-dihydroxy-4-methylpentyl)pyrimidin-2-one?
The IUPAC name of 4-amino-1-(1,5-dihydroxy-4-methylpentyl)pyrimidin-2-one (CID 18348321) is 4-amino-1-(1,5-dihydroxy-4-methylpentyl)pyrimidin-2-one.
What is the SMILES notation for 4-amino-1-(1,5-dihydroxy-4-methylpentyl)pyrimidin-2-one?
The canonical SMILES for 4-amino-1-(1,5-dihydroxy-4-methylpentyl)pyrimidin-2-one is CC(CO)CCC(O)n1ccc(N)nc1=O.
What is the InChIKey of 4-amino-1-(1,5-dihydroxy-4-methylpentyl)pyrimidin-2-one?
The InChIKey is JWSCAKDDIKYXHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O3/c1-7(6-14)2-3-9(15)13-5-4-8(11)12-10(13)16/h4-5,7,9,14-15H,2-3,6H2,1H3,(H2,11,12,16).
What are the key properties of 4-amino-1-(1,5-dihydroxy-4-methylpentyl)pyrimidin-2-one?
4-amino-1-(1,5-dihydroxy-4-methylpentyl)pyrimidin-2-one has a molecular weight of 227.26 g/mol, XLogP of -0.28, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-(1,5-dihydroxy-4-methylpentyl)pyrimidin-2-one is sourced from PubChem (CID 18348321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).