C27H28O5 — CID 18348647
2,3-dimethoxy-7-[2-(4-phenylphenoxy)ethyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulene-1,4-dione (PubChem CID 18348647) has the molecular formula C27H28O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2,3-dimethoxy-7-[2-(4-phenylphenoxy)ethyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulene-1,4-dione.
| Compound Name | 2,3-dimethoxy-7-[2-(4-phenylphenoxy)ethyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulene-1,4-dione |
|---|---|
| PubChem CID | 18348647 |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 2,3-dimethoxy-7-[2-(4-phenylphenoxy)ethyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C2=C(CCC(CCOc3ccc(-c4ccccc4)cc3)CC2)C1=O |
| InChI | InChI=1S/C27H28O5/c1-30-26-24(28)22-14-8-18(9-15-23(22)25(29)27(26)31-2)16-17-32-21-12-10-20(11-13-21)19-6-4-3-5-7-19/h3-7,10-13,18H,8-9,14-17H2,1-2H3 |
| InChIKey | YZMLEFITSWPZPV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|