C28H34O8 — CID 18348672
2-[6-(5,6-dimethoxy-4,7-dioxo-2,3-dihydro-1H-inden-2-yl)hexyl]-5,6-dimethoxy-2,3-dihydro-1H-indene-4,7-dione (PubChem CID 18348672) has the molecular formula C28H34O8 and a molecular weight of 498.57 g/mol. Its IUPAC name is 2-[6-(5,6-dimethoxy-4,7-dioxo-2,3-dihydro-1H-inden-2-yl)hexyl]-5,6-dimethoxy-2,3-dihydro-1H-indene-4,7-dione.
| Compound Name | 2-[6-(5,6-dimethoxy-4,7-dioxo-2,3-dihydro-1H-inden-2-yl)hexyl]-5,6-dimethoxy-2,3-dihydro-1H-indene-4,7-dione |
|---|---|
| PubChem CID | 18348672 |
| Molecular Formula | C28H34O8 |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 2-[6-(5,6-dimethoxy-4,7-dioxo-2,3-dihydro-1H-inden-2-yl)hexyl]-5,6-dimethoxy-2,3-dihydro-1H-indene-4,7-dione |
| SMILES | COC1=C(OC)C(=O)C2=C(CC(CCCCCCC3CC4=C(C3)C(=O)C(OC)=C(OC)C4=O)C2)C1=O |
| InChI | InChI=1S/C28H34O8/c1-33-25-21(29)17-11-15(12-18(17)22(30)26(25)34-2)9-7-5-6-8-10-16-13-19-20(14-16)24(32)28(36-4)27(35-3)23(19)31/h15-16H,5-14H2,1-4H3 |
| InChIKey | KSPGAQVKBHGQLV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|