C23H27ClN6O2 — CID 18348932
3-chloro-N-cyclopentyl-5-[2-(pyridin-4-ylamino)ethoxy]-N-[2-(1,2,4-triazol-1-yl)ethyl]benzamide (PubChem CID 18348932) has the molecular formula C23H27ClN6O2 and a molecular weight of 454.96 g/mol. Its IUPAC name is 3-chloro-N-cyclopentyl-5-[2-(pyridin-4-ylamino)ethoxy]-N-[2-(1,2,4-triazol-1-yl)ethyl]benzamide.
| Compound Name | 3-chloro-N-cyclopentyl-5-[2-(pyridin-4-ylamino)ethoxy]-N-[2-(1,2,4-triazol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 18348932 |
| Molecular Formula | C23H27ClN6O2 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 3-chloro-N-cyclopentyl-5-[2-(pyridin-4-ylamino)ethoxy]-N-[2-(1,2,4-triazol-1-yl)ethyl]benzamide |
| SMILES | O=C(c1cc(Cl)cc(OCCNc2ccncc2)c1)N(CCn1cncn1)C1CCCC1 |
| InChI | InChI=1S/C23H27ClN6O2/c24-19-13-18(14-22(15-19)32-12-9-27-20-5-7-25-8-6-20)23(31)30(21-3-1-2-4-21)11-10-29-17-26-16-28-29/h5-8,13-17,21H,1-4,9-12H2,(H,25,27) |
| InChIKey | SLHVYYMXGHNERT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|