About N-[2-(1,2,4-triazol-1-yl)ethyl]propan-2-amine
N-[2-(1,2,4-triazol-1-yl)ethyl]propan-2-amine (PubChem CID 18349040) has the molecular formula C7H14N4
and a molecular weight of 154.22 g/mol. Its IUPAC name is N-[2-(1,2,4-triazol-1-yl)ethyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[2-(1,2,4-triazol-1-yl)ethyl]propan-2-amine |
| PubChem CID | 18349040 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | N-[2-(1,2,4-triazol-1-yl)ethyl]propan-2-amine |
| SMILES | CC(C)NCCn1cncn1 |
| InChI | InChI=1S/C7H14N4/c1-7(2)9-3-4-11-6-8-5-10-11/h5-7,9H,3-4H2,1-2H3 |
| InChIKey | VOVCQXFSFWCRIJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(1,2,4-triazol-1-yl)ethyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,2,4-triazol-1-yl)ethyl]propan-2-amine?
The IUPAC name of N-[2-(1,2,4-triazol-1-yl)ethyl]propan-2-amine (CID 18349040) is N-[2-(1,2,4-triazol-1-yl)ethyl]propan-2-amine.
What is the SMILES notation for N-[2-(1,2,4-triazol-1-yl)ethyl]propan-2-amine?
The canonical SMILES for N-[2-(1,2,4-triazol-1-yl)ethyl]propan-2-amine is CC(C)NCCn1cncn1.
What is the InChIKey of N-[2-(1,2,4-triazol-1-yl)ethyl]propan-2-amine?
The InChIKey is VOVCQXFSFWCRIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4/c1-7(2)9-3-4-11-6-8-5-10-11/h5-7,9H,3-4H2,1-2H3.
What are the key properties of N-[2-(1,2,4-triazol-1-yl)ethyl]propan-2-amine?
N-[2-(1,2,4-triazol-1-yl)ethyl]propan-2-amine has a molecular weight of 154.22 g/mol, XLogP of 0.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,2,4-triazol-1-yl)ethyl]propan-2-amine is sourced from PubChem (CID 18349040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).