C9H17F3N2O2S — CID 18349082
N-[3-(cyclopentylamino)propyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 18349082) has the molecular formula C9H17F3N2O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is N-[3-(cyclopentylamino)propyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[3-(cyclopentylamino)propyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 18349082 |
| Molecular Formula | C9H17F3N2O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | N-[3-(cyclopentylamino)propyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(NCCCNC1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O2S/c10-9(11,12)17(15,16)14-7-3-6-13-8-4-1-2-5-8/h8,13-14H,1-7H2 |
| InChIKey | HICDANZFJZPWTB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|