About hydrazine;pyrrolidine-2,5-dione
hydrazine;pyrrolidine-2,5-dione (PubChem CID 18349325) has the molecular formula C4H9N3O2
and a molecular weight of 131.14 g/mol. Its IUPAC name is hydrazine;pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | hydrazine;pyrrolidine-2,5-dione |
| PubChem CID | 18349325 |
| Molecular Formula | C4H9N3O2 |
| Molecular Weight | 131.14 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | hydrazine;pyrrolidine-2,5-dione |
| SMILES | NN.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C4H5NO2.H4N2/c6-3-1-2-4(7)5-3;1-2/h1-2H2,(H,5,6,7);1-2H2 |
| InChIKey | GJXKWFLORSQAFB-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.14 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;pyrrolidine-2,5-dione?
The IUPAC name of hydrazine;pyrrolidine-2,5-dione (CID 18349325) is hydrazine;pyrrolidine-2,5-dione.
What is the SMILES notation for hydrazine;pyrrolidine-2,5-dione?
The canonical SMILES for hydrazine;pyrrolidine-2,5-dione is NN.O=C1CCC(=O)N1.
What is the InChIKey of hydrazine;pyrrolidine-2,5-dione?
The InChIKey is GJXKWFLORSQAFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.H4N2/c6-3-1-2-4(7)5-3;1-2/h1-2H2,(H,5,6,7);1-2H2.
What are the key properties of hydrazine;pyrrolidine-2,5-dione?
hydrazine;pyrrolidine-2,5-dione has a molecular weight of 131.14 g/mol, XLogP of -1.76, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;pyrrolidine-2,5-dione is sourced from PubChem (CID 18349325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).