About (2-chloro-1,3-thiazol-5-yl)methanamine;hydrochloride
(2-chloro-1,3-thiazol-5-yl)methanamine;hydrochloride (PubChem CID 18349540) has the molecular formula C4H6Cl2N2S
and a molecular weight of 185.08 g/mol. Its IUPAC name is (2-chloro-1,3-thiazol-5-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (2-chloro-1,3-thiazol-5-yl)methanamine;hydrochloride |
| PubChem CID | 18349540 |
| Molecular Formula | C4H6Cl2N2S |
| Molecular Weight | 185.08 g/mol |
| Exact Mass | 183.96 |
| IUPAC Name | (2-chloro-1,3-thiazol-5-yl)methanamine;hydrochloride |
| SMILES | Cl.NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C4H5ClN2S.ClH/c5-4-7-2-3(1-6)8-4;/h2H,1,6H2;1H |
| InChIKey | QWCUHOCIRYNOOH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.08 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-chloro-1,3-thiazol-5-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-1,3-thiazol-5-yl)methanamine;hydrochloride?
The IUPAC name of (2-chloro-1,3-thiazol-5-yl)methanamine;hydrochloride (CID 18349540) is (2-chloro-1,3-thiazol-5-yl)methanamine;hydrochloride.
What is the SMILES notation for (2-chloro-1,3-thiazol-5-yl)methanamine;hydrochloride?
The canonical SMILES for (2-chloro-1,3-thiazol-5-yl)methanamine;hydrochloride is Cl.NCc1cnc(Cl)s1.
What is the InChIKey of (2-chloro-1,3-thiazol-5-yl)methanamine;hydrochloride?
The InChIKey is QWCUHOCIRYNOOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClN2S.ClH/c5-4-7-2-3(1-6)8-4;/h2H,1,6H2;1H.
What are the key properties of (2-chloro-1,3-thiazol-5-yl)methanamine;hydrochloride?
(2-chloro-1,3-thiazol-5-yl)methanamine;hydrochloride has a molecular weight of 185.08 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-1,3-thiazol-5-yl)methanamine;hydrochloride is sourced from PubChem (CID 18349540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).