About [2-(3-imidazol-1-ylpropylamino)-2-methylpropyl] benzoate;dihydrochloride
[2-(3-imidazol-1-ylpropylamino)-2-methylpropyl] benzoate;dihydrochloride (PubChem CID 18349717) has the molecular formula C17H25Cl2N3O2
and a molecular weight of 374.31 g/mol. Its IUPAC name is [2-(3-imidazol-1-ylpropylamino)-2-methylpropyl] benzoate;dihydrochloride.
Molecular Properties
| Compound Name | [2-(3-imidazol-1-ylpropylamino)-2-methylpropyl] benzoate;dihydrochloride |
| PubChem CID | 18349717 |
| Molecular Formula | C17H25Cl2N3O2 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [2-(3-imidazol-1-ylpropylamino)-2-methylpropyl] benzoate;dihydrochloride |
| SMILES | CC(C)(COC(=O)c1ccccc1)NCCCn1ccnc1.Cl.Cl |
| InChI | InChI=1S/C17H23N3O2.2ClH/c1-17(2,19-9-6-11-20-12-10-18-14-20)13-22-16(21)15-7-4-3-5-8-15;;/h3-5,7-8,10,12,14,19H,6,9,11,13H2,1-2H3;2*1H |
| InChIKey | ZPYMYZBCIGLQKN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-(3-imidazol-1-ylpropylamino)-2-methylpropyl] benzoate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-imidazol-1-ylpropylamino)-2-methylpropyl] benzoate;dihydrochloride?
The IUPAC name of [2-(3-imidazol-1-ylpropylamino)-2-methylpropyl] benzoate;dihydrochloride (CID 18349717) is [2-(3-imidazol-1-ylpropylamino)-2-methylpropyl] benzoate;dihydrochloride.
What is the SMILES notation for [2-(3-imidazol-1-ylpropylamino)-2-methylpropyl] benzoate;dihydrochloride?
The canonical SMILES for [2-(3-imidazol-1-ylpropylamino)-2-methylpropyl] benzoate;dihydrochloride is CC(C)(COC(=O)c1ccccc1)NCCCn1ccnc1.Cl.Cl.
What is the InChIKey of [2-(3-imidazol-1-ylpropylamino)-2-methylpropyl] benzoate;dihydrochloride?
The InChIKey is ZPYMYZBCIGLQKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O2.2ClH/c1-17(2,19-9-6-11-20-12-10-18-14-20)13-22-16(21)15-7-4-3-5-8-15;;/h3-5,7-8,10,12,14,19H,6,9,11,13H2,1-2H3;2*1H.
What are the key properties of [2-(3-imidazol-1-ylpropylamino)-2-methylpropyl] benzoate;dihydrochloride?
[2-(3-imidazol-1-ylpropylamino)-2-methylpropyl] benzoate;dihydrochloride has a molecular weight of 374.31 g/mol, XLogP of 3.34, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-imidazol-1-ylpropylamino)-2-methylpropyl] benzoate;dihydrochloride is sourced from PubChem (CID 18349717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).