About 2-hydroxyethyl hydrogen carbonate
2-hydroxyethyl hydrogen carbonate (PubChem CID 18349963) has the molecular formula C3H6O4
and a molecular weight of 106.08 g/mol. Its IUPAC name is 2-hydroxyethyl hydrogen carbonate.
Molecular Properties
| Compound Name | 2-hydroxyethyl hydrogen carbonate |
| PubChem CID | 18349963 |
| Molecular Formula | C3H6O4 |
| Molecular Weight | 106.08 g/mol |
| Exact Mass | 106.03 |
| IUPAC Name | 2-hydroxyethyl hydrogen carbonate |
| SMILES | O=C(O)OCCO |
| InChI | InChI=1S/C3H6O4/c4-1-2-7-3(5)6/h4H,1-2H2,(H,5,6) |
| InChIKey | BBRSEFOSZWEMPE-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.08 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxyethyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl hydrogen carbonate?
The IUPAC name of 2-hydroxyethyl hydrogen carbonate (CID 18349963) is 2-hydroxyethyl hydrogen carbonate.
What is the SMILES notation for 2-hydroxyethyl hydrogen carbonate?
The canonical SMILES for 2-hydroxyethyl hydrogen carbonate is O=C(O)OCCO.
What is the InChIKey of 2-hydroxyethyl hydrogen carbonate?
The InChIKey is BBRSEFOSZWEMPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O4/c4-1-2-7-3(5)6/h4H,1-2H2,(H,5,6).
What are the key properties of 2-hydroxyethyl hydrogen carbonate?
2-hydroxyethyl hydrogen carbonate has a molecular weight of 106.08 g/mol, XLogP of -0.33, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl hydrogen carbonate is sourced from PubChem (CID 18349963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).