About butyl [5-(thiolan-1-ium-1-yl)naphthalen-2-yl] carbonate;trifluoromethanesulfonate
butyl [5-(thiolan-1-ium-1-yl)naphthalen-2-yl] carbonate;trifluoromethanesulfonate (PubChem CID 18350227) has the molecular formula C20H23F3O6S2
and a molecular weight of 480.53 g/mol. Its IUPAC name is butyl [5-(thiolan-1-ium-1-yl)naphthalen-2-yl] carbonate;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | butyl [5-(thiolan-1-ium-1-yl)naphthalen-2-yl] carbonate;trifluoromethanesulfonate |
| PubChem CID | 18350227 |
| Molecular Formula | C20H23F3O6S2 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | butyl [5-(thiolan-1-ium-1-yl)naphthalen-2-yl] carbonate;trifluoromethanesulfonate |
| SMILES | CCCCOC(=O)Oc1ccc2c([S+]3CCCC3)cccc2c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C19H23O3S.CHF3O3S/c1-2-3-11-21-19(20)22-16-9-10-17-15(14-16)7-6-8-18(17)23-12-4-5-13-23;2-1(3,4)8(5,6)7/h6-10,14H,2-5,11-13H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | WJARUOSFCWCFNF-UHFFFAOYSA-M |
| XLogP | 4.98 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze butyl [5-(thiolan-1-ium-1-yl)naphthalen-2-yl] carbonate;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl [5-(thiolan-1-ium-1-yl)naphthalen-2-yl] carbonate;trifluoromethanesulfonate?
The IUPAC name of butyl [5-(thiolan-1-ium-1-yl)naphthalen-2-yl] carbonate;trifluoromethanesulfonate (CID 18350227) is butyl [5-(thiolan-1-ium-1-yl)naphthalen-2-yl] carbonate;trifluoromethanesulfonate.
What is the SMILES notation for butyl [5-(thiolan-1-ium-1-yl)naphthalen-2-yl] carbonate;trifluoromethanesulfonate?
The canonical SMILES for butyl [5-(thiolan-1-ium-1-yl)naphthalen-2-yl] carbonate;trifluoromethanesulfonate is CCCCOC(=O)Oc1ccc2c([S+]3CCCC3)cccc2c1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of butyl [5-(thiolan-1-ium-1-yl)naphthalen-2-yl] carbonate;trifluoromethanesulfonate?
The InChIKey is WJARUOSFCWCFNF-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H23O3S.CHF3O3S/c1-2-3-11-21-19(20)22-16-9-10-17-15(14-16)7-6-8-18(17)23-12-4-5-13-23;2-1(3,4)8(5,6)7/h6-10,14H,2-5,11-13H2,1H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of butyl [5-(thiolan-1-ium-1-yl)naphthalen-2-yl] carbonate;trifluoromethanesulfonate?
butyl [5-(thiolan-1-ium-1-yl)naphthalen-2-yl] carbonate;trifluoromethanesulfonate has a molecular weight of 480.53 g/mol, XLogP of 4.98, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butyl [5-(thiolan-1-ium-1-yl)naphthalen-2-yl] carbonate;trifluoromethanesulfonate is sourced from PubChem (CID 18350227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).