About (2Z)-2-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-3H-inden-1-one
(2Z)-2-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-3H-inden-1-one (PubChem CID 18350334) has the molecular formula C20H18OS2
and a molecular weight of 338.50 g/mol. Its IUPAC name is (2Z)-2-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-3H-inden-1-one.
Molecular Properties
| Compound Name | (2Z)-2-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-3H-inden-1-one |
| PubChem CID | 18350334 |
| Molecular Formula | C20H18OS2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (2Z)-2-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-3H-inden-1-one |
| SMILES | CC(C)(C)c1ccc2c(c1)S/C(=C1/Cc3ccccc3C1=O)S2 |
| InChI | InChI=1S/C20H18OS2/c1-20(2,3)13-8-9-16-17(11-13)23-19(22-16)15-10-12-6-4-5-7-14(12)18(15)21/h4-9,11H,10H2,1-3H3/b19-15- |
| InChIKey | TVZCFJBIPSOIPJ-CYVLTUHYSA-N |
| XLogP | 5.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-3H-inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-3H-inden-1-one?
The IUPAC name of (2Z)-2-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-3H-inden-1-one (CID 18350334) is (2Z)-2-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-3H-inden-1-one.
What is the SMILES notation for (2Z)-2-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-3H-inden-1-one?
The canonical SMILES for (2Z)-2-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-3H-inden-1-one is CC(C)(C)c1ccc2c(c1)S/C(=C1/Cc3ccccc3C1=O)S2.
What is the InChIKey of (2Z)-2-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-3H-inden-1-one?
The InChIKey is TVZCFJBIPSOIPJ-CYVLTUHYSA-N. The full InChI is InChI=1S/C20H18OS2/c1-20(2,3)13-8-9-16-17(11-13)23-19(22-16)15-10-12-6-4-5-7-14(12)18(15)21/h4-9,11H,10H2,1-3H3/b19-15-.
What are the key properties of (2Z)-2-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-3H-inden-1-one?
(2Z)-2-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-3H-inden-1-one has a molecular weight of 338.50 g/mol, XLogP of 5.83, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(5-tert-butyl-1,3-benzodithiol-2-ylidene)-3H-inden-1-one is sourced from PubChem (CID 18350334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).