C31H40N2O2 — CID 18352019
N-tert-butyl-2-[(4-tert-butylphenyl)methylamino]-3-(4-phenylmethoxyphenyl)propanamide (PubChem CID 18352019) has the molecular formula C31H40N2O2 and a molecular weight of 472.67 g/mol. Its IUPAC name is N-tert-butyl-2-[(4-tert-butylphenyl)methylamino]-3-(4-phenylmethoxyphenyl)propanamide.
| Compound Name | N-tert-butyl-2-[(4-tert-butylphenyl)methylamino]-3-(4-phenylmethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 18352019 |
| Molecular Formula | C31H40N2O2 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | N-tert-butyl-2-[(4-tert-butylphenyl)methylamino]-3-(4-phenylmethoxyphenyl)propanamide |
| SMILES | CC(C)(C)NC(=O)C(Cc1ccc(OCc2ccccc2)cc1)NCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H40N2O2/c1-30(2,3)26-16-12-24(13-17-26)21-32-28(29(34)33-31(4,5)6)20-23-14-18-27(19-15-23)35-22-25-10-8-7-9-11-25/h7-19,28,32H,20-22H2,1-6H3,(H,33,34) |
| InChIKey | GXSMUDXAIPXMFM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |