C11H12F3N3O — CID 18352162
3-hydroxy-8-(2,2,2-trifluoroethyl)-8-azabicyclo[3.2.1]octane-1,3-dicarbonitrile (PubChem CID 18352162) has the molecular formula C11H12F3N3O and a molecular weight of 259.23 g/mol. Its IUPAC name is 3-hydroxy-8-(2,2,2-trifluoroethyl)-8-azabicyclo[3.2.1]octane-1,3-dicarbonitrile.
| Compound Name | 3-hydroxy-8-(2,2,2-trifluoroethyl)-8-azabicyclo[3.2.1]octane-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 18352162 |
| Molecular Formula | C11H12F3N3O |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 3-hydroxy-8-(2,2,2-trifluoroethyl)-8-azabicyclo[3.2.1]octane-1,3-dicarbonitrile |
| SMILES | N#CC1(O)CC2CCC(C#N)(C1)N2CC(F)(F)F |
| InChI | InChI=1S/C11H12F3N3O/c12-11(13,14)7-17-8-1-2-9(17,5-15)4-10(18,3-8)6-16/h8,18H,1-4,7H2 |
| InChIKey | KNBCYAPWVNJNJO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|