About N-pyrrol-1-ylbutanamide
N-pyrrol-1-ylbutanamide (PubChem CID 18352167) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is N-pyrrol-1-ylbutanamide.
Molecular Properties
| Compound Name | N-pyrrol-1-ylbutanamide |
| PubChem CID | 18352167 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | N-pyrrol-1-ylbutanamide |
| SMILES | CCCC(=O)Nn1cccc1 |
| InChI | InChI=1S/C8H12N2O/c1-2-5-8(11)9-10-6-3-4-7-10/h3-4,6-7H,2,5H2,1H3,(H,9,11) |
| InChIKey | CHXNZWZIISEOMP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-pyrrol-1-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyrrol-1-ylbutanamide?
The IUPAC name of N-pyrrol-1-ylbutanamide (CID 18352167) is N-pyrrol-1-ylbutanamide.
What is the SMILES notation for N-pyrrol-1-ylbutanamide?
The canonical SMILES for N-pyrrol-1-ylbutanamide is CCCC(=O)Nn1cccc1.
What is the InChIKey of N-pyrrol-1-ylbutanamide?
The InChIKey is CHXNZWZIISEOMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-2-5-8(11)9-10-6-3-4-7-10/h3-4,6-7H,2,5H2,1H3,(H,9,11).
What are the key properties of N-pyrrol-1-ylbutanamide?
N-pyrrol-1-ylbutanamide has a molecular weight of 152.20 g/mol, XLogP of 1.36, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyrrol-1-ylbutanamide is sourced from PubChem (CID 18352167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).