C18H29ClN2O2S — CID 18352733
1-(3-chlorophenyl)-N-ethyl-N-[(1-methylsulfonylpiperidin-4-yl)methyl]propan-2-amine (PubChem CID 18352733) has the molecular formula C18H29ClN2O2S and a molecular weight of 372.96 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-ethyl-N-[(1-methylsulfonylpiperidin-4-yl)methyl]propan-2-amine.
| Compound Name | 1-(3-chlorophenyl)-N-ethyl-N-[(1-methylsulfonylpiperidin-4-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 18352733 |
| Molecular Formula | C18H29ClN2O2S |
| Molecular Weight | 372.96 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-(3-chlorophenyl)-N-ethyl-N-[(1-methylsulfonylpiperidin-4-yl)methyl]propan-2-amine |
| SMILES | CCN(CC1CCN(S(C)(=O)=O)CC1)C(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H29ClN2O2S/c1-4-20(15(2)12-17-6-5-7-18(19)13-17)14-16-8-10-21(11-9-16)24(3,22)23/h5-7,13,15-16H,4,8-12,14H2,1-3H3 |
| InChIKey | ZOXLTZFWSXPRTN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.96 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |