C40H48F3N3O10 — CID 18352834
2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;4-[[ethyl-[1-[4-(2,2,2-trifluoroethoxy)phenyl]propan-2-yl]amino]methyl]-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 18352834) has the molecular formula C40H48F3N3O10 and a molecular weight of 787.83 g/mol. Its IUPAC name is 2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;4-[[ethyl-[1-[4-(2,2,2-trifluoroethoxy)phenyl]propan-2-yl]amino]methyl]-N,N-dimethylpiperidine-1-carboxamide.
| Compound Name | 2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;4-[[ethyl-[1-[4-(2,2,2-trifluoroethoxy)phenyl]propan-2-yl]amino]methyl]-N,N-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 18352834 |
| Molecular Formula | C40H48F3N3O10 |
| Molecular Weight | 787.83 g/mol |
| Exact Mass | 787.33 |
| IUPAC Name | 2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;4-[[ethyl-[1-[4-(2,2,2-trifluoroethoxy)phenyl]propan-2-yl]amino]methyl]-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | CCN(CC1CCN(C(=O)N(C)C)CC1)C(C)Cc1ccc(OCC(F)(F)F)cc1.O=C(O)C(O)(C(=O)c1ccccc1)C(O)(C(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H34F3N3O2.C18H14O8/c1-5-27(15-19-10-12-28(13-11-19)21(29)26(3)4)17(2)14-18-6-8-20(9-7-18)30-16-22(23,24)25;19-13(11-7-3-1-4-8-11)17(25,15(21)22)18(26,16(23)24)14(20)12-9-5-2-6-10-12/h6-9,17,19H,5,10-16H2,1-4H3;1-10,25-26H,(H,21,22)(H,23,24) |
| InChIKey | BMXIIZPTWNYAGO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 185.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.83 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|