C39H48ClN3O9 — CID 18352954
4-[[1-[3-(chloromethyl)phenyl]propan-2-yl-ethylamino]methyl]-N,N-dimethylpiperidine-1-carboxamide;2,3-dibenzoyl-2,3-dihydroxybutanedioic acid (PubChem CID 18352954) has the molecular formula C39H48ClN3O9 and a molecular weight of 738.28 g/mol. Its IUPAC name is 4-[[1-[3-(chloromethyl)phenyl]propan-2-yl-ethylamino]methyl]-N,N-dimethylpiperidine-1-carboxamide;2,3-dibenzoyl-2,3-dihydroxybutanedioic acid.
| Compound Name | 4-[[1-[3-(chloromethyl)phenyl]propan-2-yl-ethylamino]methyl]-N,N-dimethylpiperidine-1-carboxamide;2,3-dibenzoyl-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 18352954 |
| Molecular Formula | C39H48ClN3O9 |
| Molecular Weight | 738.28 g/mol |
| Exact Mass | 737.31 |
| IUPAC Name | 4-[[1-[3-(chloromethyl)phenyl]propan-2-yl-ethylamino]methyl]-N,N-dimethylpiperidine-1-carboxamide;2,3-dibenzoyl-2,3-dihydroxybutanedioic acid |
| SMILES | CCN(CC1CCN(C(=O)N(C)C)CC1)C(C)Cc1cccc(CCl)c1.O=C(O)C(O)(C(=O)c1ccccc1)C(O)(C(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H34ClN3O.C18H14O8/c1-5-24(17(2)13-19-7-6-8-20(14-19)15-22)16-18-9-11-25(12-10-18)21(26)23(3)4;19-13(11-7-3-1-4-8-11)17(25,15(21)22)18(26,16(23)24)14(20)12-9-5-2-6-10-12/h6-8,14,17-18H,5,9-13,15-16H2,1-4H3;1-10,25-26H,(H,21,22)(H,23,24) |
| InChIKey | WLZAIVRVTKCYKZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 175.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.28 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|