About 2-propyl-7H-purine;hydrochloride
2-propyl-7H-purine;hydrochloride (PubChem CID 18353371) has the molecular formula C8H11ClN4
and a molecular weight of 198.66 g/mol. Its IUPAC name is 2-propyl-7H-purine;hydrochloride.
Molecular Properties
| Compound Name | 2-propyl-7H-purine;hydrochloride |
| PubChem CID | 18353371 |
| Molecular Formula | C8H11ClN4 |
| Molecular Weight | 198.66 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 2-propyl-7H-purine;hydrochloride |
| SMILES | CCCc1ncc2[nH]cnc2n1.Cl |
| InChI | InChI=1S/C8H10N4.ClH/c1-2-3-7-9-4-6-8(12-7)11-5-10-6;/h4-5H,2-3H2,1H3,(H,9,10,11,12);1H |
| InChIKey | SWMRJCLHCPFQNM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.66 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propyl-7H-purine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-7H-purine;hydrochloride?
The IUPAC name of 2-propyl-7H-purine;hydrochloride (CID 18353371) is 2-propyl-7H-purine;hydrochloride.
What is the SMILES notation for 2-propyl-7H-purine;hydrochloride?
The canonical SMILES for 2-propyl-7H-purine;hydrochloride is CCCc1ncc2[nH]cnc2n1.Cl.
What is the InChIKey of 2-propyl-7H-purine;hydrochloride?
The InChIKey is SWMRJCLHCPFQNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4.ClH/c1-2-3-7-9-4-6-8(12-7)11-5-10-6;/h4-5H,2-3H2,1H3,(H,9,10,11,12);1H.
What are the key properties of 2-propyl-7H-purine;hydrochloride?
2-propyl-7H-purine;hydrochloride has a molecular weight of 198.66 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-7H-purine;hydrochloride is sourced from PubChem (CID 18353371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).