2-oxo-1,3-oxazolidine-3-carboxylic acid

C4H5NO4 — CID 18353396

IUPAC2-oxo-1,3-oxazolidine-3-carboxylic acid
SMILESO=C(O)N1CCOC1=O
InChIInChI=1S/C4H5NO4/c6-3(7)5-1-2-9-4(5)8/h1-2H2,(H,6,7)
InChIKeyFJKYUFDYLYGXPT-UHFFFAOYSA-N
MW131.09 g/mol
LogP0.12
Rot. Bonds

About 2-oxo-1,3-oxazolidine-3-carboxylic acid

2-oxo-1,3-oxazolidine-3-carboxylic acid (PubChem CID 18353396) has the molecular formula C4H5NO4 and a molecular weight of 131.09 g/mol. Its IUPAC name is 2-oxo-1,3-oxazolidine-3-carboxylic acid.

Molecular Properties

Compound Name2-oxo-1,3-oxazolidine-3-carboxylic acid
PubChem CID18353396
Molecular FormulaC4H5NO4
Molecular Weight131.09 g/mol
Exact Mass131.02
IUPAC Name2-oxo-1,3-oxazolidine-3-carboxylic acid
SMILESO=C(O)N1CCOC1=O
InChIInChI=1S/C4H5NO4/c6-3(7)5-1-2-9-4(5)8/h1-2H2,(H,6,7)
InChIKeyFJKYUFDYLYGXPT-UHFFFAOYSA-N
XLogP0.12
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500131.09
LogP ≤ 50.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-oxo-1,3-oxazolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxo-1,3-oxazolidine-3-carboxylic acid?
The IUPAC name of 2-oxo-1,3-oxazolidine-3-carboxylic acid (CID 18353396) is 2-oxo-1,3-oxazolidine-3-carboxylic acid.
What is the SMILES notation for 2-oxo-1,3-oxazolidine-3-carboxylic acid?
The canonical SMILES for 2-oxo-1,3-oxazolidine-3-carboxylic acid is O=C(O)N1CCOC1=O.
What is the InChIKey of 2-oxo-1,3-oxazolidine-3-carboxylic acid?
The InChIKey is FJKYUFDYLYGXPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO4/c6-3(7)5-1-2-9-4(5)8/h1-2H2,(H,6,7).
What are the key properties of 2-oxo-1,3-oxazolidine-3-carboxylic acid?
2-oxo-1,3-oxazolidine-3-carboxylic acid has a molecular weight of 131.09 g/mol, XLogP of 0.12, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1,3-oxazolidine-3-carboxylic acid is sourced from PubChem (CID 18353396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).