About 3,4-diiodo-5-methylphenol
3,4-diiodo-5-methylphenol (PubChem CID 18353584) has the molecular formula C7H6I2O
and a molecular weight of 359.93 g/mol. Its IUPAC name is 3,4-diiodo-5-methylphenol.
Molecular Properties
| Compound Name | 3,4-diiodo-5-methylphenol |
| PubChem CID | 18353584 |
| Molecular Formula | C7H6I2O |
| Molecular Weight | 359.93 g/mol |
| Exact Mass | 359.85 |
| IUPAC Name | 3,4-diiodo-5-methylphenol |
| SMILES | Cc1cc(O)cc(I)c1I |
| InChI | InChI=1S/C7H6I2O/c1-4-2-5(10)3-6(8)7(4)9/h2-3,10H,1H3 |
| InChIKey | NJUMJRWQDGZSMI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.93 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diiodo-5-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diiodo-5-methylphenol?
The IUPAC name of 3,4-diiodo-5-methylphenol (CID 18353584) is 3,4-diiodo-5-methylphenol.
What is the SMILES notation for 3,4-diiodo-5-methylphenol?
The canonical SMILES for 3,4-diiodo-5-methylphenol is Cc1cc(O)cc(I)c1I.
What is the InChIKey of 3,4-diiodo-5-methylphenol?
The InChIKey is NJUMJRWQDGZSMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6I2O/c1-4-2-5(10)3-6(8)7(4)9/h2-3,10H,1H3.
What are the key properties of 3,4-diiodo-5-methylphenol?
3,4-diiodo-5-methylphenol has a molecular weight of 359.93 g/mol, XLogP of 2.91, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diiodo-5-methylphenol is sourced from PubChem (CID 18353584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).