About 2-[3-[(3,5-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one
2-[3-[(3,5-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one (PubChem CID 18353708) has the molecular formula C19H19Cl2N3O
and a molecular weight of 376.29 g/mol. Its IUPAC name is 2-[3-[(3,5-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 2-[3-[(3,5-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one |
| PubChem CID | 18353708 |
| Molecular Formula | C19H19Cl2N3O |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-[3-[(3,5-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one |
| SMILES | O=c1cc(NCCCNCc2cc(Cl)cc(Cl)c2)[nH]c2ccccc12 |
| InChI | InChI=1S/C19H19Cl2N3O/c20-14-8-13(9-15(21)10-14)12-22-6-3-7-23-19-11-18(25)16-4-1-2-5-17(16)24-19/h1-2,4-5,8-11,22H,3,6-7,12H2,(H2,23,24,25) |
| InChIKey | DOYVWGPTNKAQGR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[(3,5-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(3,5-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one?
The IUPAC name of 2-[3-[(3,5-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one (CID 18353708) is 2-[3-[(3,5-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one.
What is the SMILES notation for 2-[3-[(3,5-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one?
The canonical SMILES for 2-[3-[(3,5-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one is O=c1cc(NCCCNCc2cc(Cl)cc(Cl)c2)[nH]c2ccccc12.
What is the InChIKey of 2-[3-[(3,5-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one?
The InChIKey is DOYVWGPTNKAQGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19Cl2N3O/c20-14-8-13(9-15(21)10-14)12-22-6-3-7-23-19-11-18(25)16-4-1-2-5-17(16)24-19/h1-2,4-5,8-11,22H,3,6-7,12H2,(H2,23,24,25).
What are the key properties of 2-[3-[(3,5-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one?
2-[3-[(3,5-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one has a molecular weight of 376.29 g/mol, XLogP of 4.43, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(3,5-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one is sourced from PubChem (CID 18353708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).