About 2-[3-[(2-amino-3,5-dibromophenyl)methylamino]propylamino]-1H-quinolin-4-one
2-[3-[(2-amino-3,5-dibromophenyl)methylamino]propylamino]-1H-quinolin-4-one (PubChem CID 18353718) has the molecular formula C19H20Br2N4O
and a molecular weight of 480.20 g/mol. Its IUPAC name is 2-[3-[(2-amino-3,5-dibromophenyl)methylamino]propylamino]-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 2-[3-[(2-amino-3,5-dibromophenyl)methylamino]propylamino]-1H-quinolin-4-one |
| PubChem CID | 18353718 |
| Molecular Formula | C19H20Br2N4O |
| Molecular Weight | 480.20 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | 2-[3-[(2-amino-3,5-dibromophenyl)methylamino]propylamino]-1H-quinolin-4-one |
| SMILES | Nc1c(Br)cc(Br)cc1CNCCCNc1cc(=O)c2ccccc2[nH]1 |
| InChI | InChI=1S/C19H20Br2N4O/c20-13-8-12(19(22)15(21)9-13)11-23-6-3-7-24-18-10-17(26)14-4-1-2-5-16(14)25-18/h1-2,4-5,8-10,23H,3,6-7,11,22H2,(H2,24,25,26) |
| InChIKey | ADTALONONYMGSZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.20 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[(2-amino-3,5-dibromophenyl)methylamino]propylamino]-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(2-amino-3,5-dibromophenyl)methylamino]propylamino]-1H-quinolin-4-one?
The IUPAC name of 2-[3-[(2-amino-3,5-dibromophenyl)methylamino]propylamino]-1H-quinolin-4-one (CID 18353718) is 2-[3-[(2-amino-3,5-dibromophenyl)methylamino]propylamino]-1H-quinolin-4-one.
What is the SMILES notation for 2-[3-[(2-amino-3,5-dibromophenyl)methylamino]propylamino]-1H-quinolin-4-one?
The canonical SMILES for 2-[3-[(2-amino-3,5-dibromophenyl)methylamino]propylamino]-1H-quinolin-4-one is Nc1c(Br)cc(Br)cc1CNCCCNc1cc(=O)c2ccccc2[nH]1.
What is the InChIKey of 2-[3-[(2-amino-3,5-dibromophenyl)methylamino]propylamino]-1H-quinolin-4-one?
The InChIKey is ADTALONONYMGSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20Br2N4O/c20-13-8-12(19(22)15(21)9-13)11-23-6-3-7-24-18-10-17(26)14-4-1-2-5-16(14)25-18/h1-2,4-5,8-10,23H,3,6-7,11,22H2,(H2,24,25,26).
What are the key properties of 2-[3-[(2-amino-3,5-dibromophenyl)methylamino]propylamino]-1H-quinolin-4-one?
2-[3-[(2-amino-3,5-dibromophenyl)methylamino]propylamino]-1H-quinolin-4-one has a molecular weight of 480.20 g/mol, XLogP of 4.23, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(2-amino-3,5-dibromophenyl)methylamino]propylamino]-1H-quinolin-4-one is sourced from PubChem (CID 18353718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).