About 2-[2-[(3,4-dichlorophenyl)methylamino]ethylamino]-1H-quinolin-4-one
2-[2-[(3,4-dichlorophenyl)methylamino]ethylamino]-1H-quinolin-4-one (PubChem CID 18353767) has the molecular formula C18H17Cl2N3O
and a molecular weight of 362.26 g/mol. Its IUPAC name is 2-[2-[(3,4-dichlorophenyl)methylamino]ethylamino]-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 2-[2-[(3,4-dichlorophenyl)methylamino]ethylamino]-1H-quinolin-4-one |
| PubChem CID | 18353767 |
| Molecular Formula | C18H17Cl2N3O |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-[2-[(3,4-dichlorophenyl)methylamino]ethylamino]-1H-quinolin-4-one |
| SMILES | O=c1cc(NCCNCc2ccc(Cl)c(Cl)c2)[nH]c2ccccc12 |
| InChI | InChI=1S/C18H17Cl2N3O/c19-14-6-5-12(9-15(14)20)11-21-7-8-22-18-10-17(24)13-3-1-2-4-16(13)23-18/h1-6,9-10,21H,7-8,11H2,(H2,22,23,24) |
| InChIKey | UPKRFXLLYPJONX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(3,4-dichlorophenyl)methylamino]ethylamino]-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(3,4-dichlorophenyl)methylamino]ethylamino]-1H-quinolin-4-one?
The IUPAC name of 2-[2-[(3,4-dichlorophenyl)methylamino]ethylamino]-1H-quinolin-4-one (CID 18353767) is 2-[2-[(3,4-dichlorophenyl)methylamino]ethylamino]-1H-quinolin-4-one.
What is the SMILES notation for 2-[2-[(3,4-dichlorophenyl)methylamino]ethylamino]-1H-quinolin-4-one?
The canonical SMILES for 2-[2-[(3,4-dichlorophenyl)methylamino]ethylamino]-1H-quinolin-4-one is O=c1cc(NCCNCc2ccc(Cl)c(Cl)c2)[nH]c2ccccc12.
What is the InChIKey of 2-[2-[(3,4-dichlorophenyl)methylamino]ethylamino]-1H-quinolin-4-one?
The InChIKey is UPKRFXLLYPJONX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2N3O/c19-14-6-5-12(9-15(14)20)11-21-7-8-22-18-10-17(24)13-3-1-2-4-16(13)23-18/h1-6,9-10,21H,7-8,11H2,(H2,22,23,24).
What are the key properties of 2-[2-[(3,4-dichlorophenyl)methylamino]ethylamino]-1H-quinolin-4-one?
2-[2-[(3,4-dichlorophenyl)methylamino]ethylamino]-1H-quinolin-4-one has a molecular weight of 362.26 g/mol, XLogP of 4.04, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(3,4-dichlorophenyl)methylamino]ethylamino]-1H-quinolin-4-one is sourced from PubChem (CID 18353767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).