About (5-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl methyl carbonate
(5-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl methyl carbonate (PubChem CID 18353915) has the molecular formula C8H10O6
and a molecular weight of 202.16 g/mol. Its IUPAC name is (5-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl methyl carbonate.
Molecular Properties
| Compound Name | (5-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl methyl carbonate |
| PubChem CID | 18353915 |
| Molecular Formula | C8H10O6 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | (5-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl methyl carbonate |
| SMILES | C=CC1OC(=O)OC1COC(=O)OC |
| InChI | InChI=1S/C8H10O6/c1-3-5-6(14-8(10)13-5)4-12-7(9)11-2/h3,5-6H,1,4H2,2H3 |
| InChIKey | AAXCWTGMDPSOSV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl methyl carbonate?
The IUPAC name of (5-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl methyl carbonate (CID 18353915) is (5-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl methyl carbonate.
What is the SMILES notation for (5-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl methyl carbonate?
The canonical SMILES for (5-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl methyl carbonate is C=CC1OC(=O)OC1COC(=O)OC.
What is the InChIKey of (5-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl methyl carbonate?
The InChIKey is AAXCWTGMDPSOSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O6/c1-3-5-6(14-8(10)13-5)4-12-7(9)11-2/h3,5-6H,1,4H2,2H3.
What are the key properties of (5-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl methyl carbonate?
(5-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl methyl carbonate has a molecular weight of 202.16 g/mol, XLogP of 0.86, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl methyl carbonate is sourced from PubChem (CID 18353915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).