About (2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate
(2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate (PubChem CID 18353926) has the molecular formula C7H8O5
and a molecular weight of 172.14 g/mol. Its IUPAC name is (2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate.
Molecular Properties
| Compound Name | (2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate |
| PubChem CID | 18353926 |
| Molecular Formula | C7H8O5 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | (2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1COC(=O)O1 |
| InChI | InChI=1S/C7H8O5/c1-2-6(8)10-3-5-4-11-7(9)12-5/h2,5H,1,3-4H2 |
| InChIKey | NAQYVERIASFLDB-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate?
The IUPAC name of (2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate (CID 18353926) is (2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate.
What is the SMILES notation for (2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate?
The canonical SMILES for (2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate is C=CC(=O)OCC1COC(=O)O1.
What is the InChIKey of (2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate?
The InChIKey is NAQYVERIASFLDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O5/c1-2-6(8)10-3-5-4-11-7(9)12-5/h2,5H,1,3-4H2.
What are the key properties of (2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate?
(2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate has a molecular weight of 172.14 g/mol, XLogP of 0.25, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate is sourced from PubChem (CID 18353926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).