About 2,2,6-trimethyloctane-3,5-dione
2,2,6-trimethyloctane-3,5-dione (PubChem CID 18354039) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 2,2,6-trimethyloctane-3,5-dione.
Molecular Properties
| Compound Name | 2,2,6-trimethyloctane-3,5-dione |
| PubChem CID | 18354039 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2,2,6-trimethyloctane-3,5-dione |
| SMILES | CCC(C)C(=O)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H20O2/c1-6-8(2)9(12)7-10(13)11(3,4)5/h8H,6-7H2,1-5H3 |
| InChIKey | XGGCYHBYGFNQIP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2,6-trimethyloctane-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,6-trimethyloctane-3,5-dione?
The IUPAC name of 2,2,6-trimethyloctane-3,5-dione (CID 18354039) is 2,2,6-trimethyloctane-3,5-dione.
What is the SMILES notation for 2,2,6-trimethyloctane-3,5-dione?
The canonical SMILES for 2,2,6-trimethyloctane-3,5-dione is CCC(C)C(=O)CC(=O)C(C)(C)C.
What is the InChIKey of 2,2,6-trimethyloctane-3,5-dione?
The InChIKey is XGGCYHBYGFNQIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-6-8(2)9(12)7-10(13)11(3,4)5/h8H,6-7H2,1-5H3.
What are the key properties of 2,2,6-trimethyloctane-3,5-dione?
2,2,6-trimethyloctane-3,5-dione has a molecular weight of 184.28 g/mol, XLogP of 2.61, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,6-trimethyloctane-3,5-dione is sourced from PubChem (CID 18354039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).