About (2-ethylmorpholin-2-yl) prop-2-enoate
(2-ethylmorpholin-2-yl) prop-2-enoate (PubChem CID 18354054) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is (2-ethylmorpholin-2-yl) prop-2-enoate.
Molecular Properties
| Compound Name | (2-ethylmorpholin-2-yl) prop-2-enoate |
| PubChem CID | 18354054 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | (2-ethylmorpholin-2-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1(CC)CNCCO1 |
| InChI | InChI=1S/C9H15NO3/c1-3-8(11)13-9(4-2)7-10-5-6-12-9/h3,10H,1,4-7H2,2H3 |
| InChIKey | DZICBGZNHVCADA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2-ethylmorpholin-2-yl) prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethylmorpholin-2-yl) prop-2-enoate?
The IUPAC name of (2-ethylmorpholin-2-yl) prop-2-enoate (CID 18354054) is (2-ethylmorpholin-2-yl) prop-2-enoate.
What is the SMILES notation for (2-ethylmorpholin-2-yl) prop-2-enoate?
The canonical SMILES for (2-ethylmorpholin-2-yl) prop-2-enoate is C=CC(=O)OC1(CC)CNCCO1.
What is the InChIKey of (2-ethylmorpholin-2-yl) prop-2-enoate?
The InChIKey is DZICBGZNHVCADA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-3-8(11)13-9(4-2)7-10-5-6-12-9/h3,10H,1,4-7H2,2H3.
What are the key properties of (2-ethylmorpholin-2-yl) prop-2-enoate?
(2-ethylmorpholin-2-yl) prop-2-enoate has a molecular weight of 185.22 g/mol, XLogP of 0.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethylmorpholin-2-yl) prop-2-enoate is sourced from PubChem (CID 18354054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).