C11H9FN2O3 — CID 18354311
7-fluorospiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 18354311) has the molecular formula C11H9FN2O3 and a molecular weight of 236.20 g/mol. Its IUPAC name is 7-fluorospiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 7-fluorospiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 18354311 |
| Molecular Formula | C11H9FN2O3 |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 7-fluorospiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC(=O)C2(CCOc3cc(F)ccc32)N1 |
| InChI | InChI=1S/C11H9FN2O3/c12-6-1-2-7-8(5-6)17-4-3-11(7)9(15)13-10(16)14-11/h1-2,5H,3-4H2,(H2,13,14,15,16) |
| InChIKey | JACHJSRYXFAULG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|