About 1-morpholin-4-ylethane-1,2-diamine
1-morpholin-4-ylethane-1,2-diamine (PubChem CID 18354329) has the molecular formula C6H15N3O
and a molecular weight of 145.21 g/mol. Its IUPAC name is 1-morpholin-4-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-morpholin-4-ylethane-1,2-diamine |
| PubChem CID | 18354329 |
| Molecular Formula | C6H15N3O |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | 1-morpholin-4-ylethane-1,2-diamine |
| SMILES | NCC(N)N1CCOCC1 |
| InChI | InChI=1S/C6H15N3O/c7-5-6(8)9-1-3-10-4-2-9/h6H,1-5,7-8H2 |
| InChIKey | SZNOZZJSVRAGGS-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-morpholin-4-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-ylethane-1,2-diamine?
The IUPAC name of 1-morpholin-4-ylethane-1,2-diamine (CID 18354329) is 1-morpholin-4-ylethane-1,2-diamine.
What is the SMILES notation for 1-morpholin-4-ylethane-1,2-diamine?
The canonical SMILES for 1-morpholin-4-ylethane-1,2-diamine is NCC(N)N1CCOCC1.
What is the InChIKey of 1-morpholin-4-ylethane-1,2-diamine?
The InChIKey is SZNOZZJSVRAGGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3O/c7-5-6(8)9-1-3-10-4-2-9/h6H,1-5,7-8H2.
What are the key properties of 1-morpholin-4-ylethane-1,2-diamine?
1-morpholin-4-ylethane-1,2-diamine has a molecular weight of 145.21 g/mol, XLogP of -1.44, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-ylethane-1,2-diamine is sourced from PubChem (CID 18354329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).