About 2-(1-hydroxy-5,6,6-trimethylcyclohexa-2,4-dien-1-yl)acetic acid
2-(1-hydroxy-5,6,6-trimethylcyclohexa-2,4-dien-1-yl)acetic acid (PubChem CID 18354335) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-(1-hydroxy-5,6,6-trimethylcyclohexa-2,4-dien-1-yl)acetic acid.
Analyze 2-(1-hydroxy-5,6,6-trimethylcyclohexa-2,4-dien-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxy-5,6,6-trimethylcyclohexa-2,4-dien-1-yl)acetic acid?
The IUPAC name of 2-(1-hydroxy-5,6,6-trimethylcyclohexa-2,4-dien-1-yl)acetic acid (CID 18354335) is 2-(1-hydroxy-5,6,6-trimethylcyclohexa-2,4-dien-1-yl)acetic acid.
What is the SMILES notation for 2-(1-hydroxy-5,6,6-trimethylcyclohexa-2,4-dien-1-yl)acetic acid?
The canonical SMILES for 2-(1-hydroxy-5,6,6-trimethylcyclohexa-2,4-dien-1-yl)acetic acid is CC1=CC=CC(O)(CC(=O)O)C1(C)C.
What is the InChIKey of 2-(1-hydroxy-5,6,6-trimethylcyclohexa-2,4-dien-1-yl)acetic acid?
The InChIKey is TUXJZJACXFJNHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-8-5-4-6-11(14,7-9(12)13)10(8,2)3/h4-6,14H,7H2,1-3H3,(H,12,13).
What are the key properties of 2-(1-hydroxy-5,6,6-trimethylcyclohexa-2,4-dien-1-yl)acetic acid?
2-(1-hydroxy-5,6,6-trimethylcyclohexa-2,4-dien-1-yl)acetic acid has a molecular weight of 196.25 g/mol, XLogP of 1.73, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxy-5,6,6-trimethylcyclohexa-2,4-dien-1-yl)acetic acid is sourced from PubChem (CID 18354335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).