C28H30N2O2 — CID 18354698
2-methoxy-4-[2-[4-(2-phenyl-1H-indol-3-yl)piperidin-1-yl]ethyl]phenol (PubChem CID 18354698) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 2-methoxy-4-[2-[4-(2-phenyl-1H-indol-3-yl)piperidin-1-yl]ethyl]phenol.
| Compound Name | 2-methoxy-4-[2-[4-(2-phenyl-1H-indol-3-yl)piperidin-1-yl]ethyl]phenol |
|---|---|
| PubChem CID | 18354698 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 2-methoxy-4-[2-[4-(2-phenyl-1H-indol-3-yl)piperidin-1-yl]ethyl]phenol |
| SMILES | COc1cc(CCN2CCC(c3c(-c4ccccc4)[nH]c4ccccc34)CC2)ccc1O |
| InChI | InChI=1S/C28H30N2O2/c1-32-26-19-20(11-12-25(26)31)13-16-30-17-14-21(15-18-30)27-23-9-5-6-10-24(23)29-28(27)22-7-3-2-4-8-22/h2-12,19,21,29,31H,13-18H2,1H3 |
| InChIKey | YGXUKOIBHNDJRZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 48.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |