About 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride
5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride (PubChem CID 18354749) has the molecular formula C13H14ClNO4S
and a molecular weight of 315.78 g/mol. Its IUPAC name is 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride.
Molecular Properties
| Compound Name | 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride |
| PubChem CID | 18354749 |
| Molecular Formula | C13H14ClNO4S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCS(=O)(=O)Cl |
| InChI | InChI=1S/C13H14ClNO4S/c14-20(18,19)9-5-1-4-8-15-12(16)10-6-2-3-7-11(10)13(15)17/h2-3,6-7H,1,4-5,8-9H2 |
| InChIKey | VOYSCQYOHPWPEV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride?
The IUPAC name of 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride (CID 18354749) is 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride.
What is the SMILES notation for 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride?
The canonical SMILES for 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride is O=C1c2ccccc2C(=O)N1CCCCCS(=O)(=O)Cl.
What is the InChIKey of 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride?
The InChIKey is VOYSCQYOHPWPEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClNO4S/c14-20(18,19)9-5-1-4-8-15-12(16)10-6-2-3-7-11(10)13(15)17/h2-3,6-7H,1,4-5,8-9H2.
What are the key properties of 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride?
5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride has a molecular weight of 315.78 g/mol, XLogP of 2.02, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride is sourced from PubChem (CID 18354749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).