C29H29F3N6O6 — CID 18354949
N-[2-methoxy-4-[methyl-[2-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenyl]-3-nitro-2-[(2,2,2-trifluoroacetyl)amino]benzamide (PubChem CID 18354949) has the molecular formula C29H29F3N6O6 and a molecular weight of 614.58 g/mol. Its IUPAC name is N-[2-methoxy-4-[methyl-[2-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenyl]-3-nitro-2-[(2,2,2-trifluoroacetyl)amino]benzamide.
| Compound Name | N-[2-methoxy-4-[methyl-[2-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenyl]-3-nitro-2-[(2,2,2-trifluoroacetyl)amino]benzamide |
|---|---|
| PubChem CID | 18354949 |
| Molecular Formula | C29H29F3N6O6 |
| Molecular Weight | 614.58 g/mol |
| Exact Mass | 614.21 |
| IUPAC Name | N-[2-methoxy-4-[methyl-[2-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenyl]-3-nitro-2-[(2,2,2-trifluoroacetyl)amino]benzamide |
| SMILES | COc1cc(C(=O)N(C)c2ccccc2N2CCN(C)CC2)ccc1NC(=O)c1cccc([N+](=O)[O-])c1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C29H29F3N6O6/c1-35-13-15-37(16-14-35)22-9-5-4-8-21(22)36(2)27(40)18-11-12-20(24(17-18)44-3)33-26(39)19-7-6-10-23(38(42)43)25(19)34-28(41)29(30,31)32/h4-12,17H,13-16H2,1-3H3,(H,33,39)(H,34,41) |
| InChIKey | AQSQKKZXAHXZNX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 137.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|