C28H26F3N5O7 — CID 18354956
N-[2-methoxy-4-[methyl-(2-morpholin-4-ylphenyl)carbamoyl]phenyl]-3-nitro-2-[(2,2,2-trifluoroacetyl)amino]benzamide (PubChem CID 18354956) has the molecular formula C28H26F3N5O7 and a molecular weight of 601.54 g/mol. Its IUPAC name is N-[2-methoxy-4-[methyl-(2-morpholin-4-ylphenyl)carbamoyl]phenyl]-3-nitro-2-[(2,2,2-trifluoroacetyl)amino]benzamide.
| Compound Name | N-[2-methoxy-4-[methyl-(2-morpholin-4-ylphenyl)carbamoyl]phenyl]-3-nitro-2-[(2,2,2-trifluoroacetyl)amino]benzamide |
|---|---|
| PubChem CID | 18354956 |
| Molecular Formula | C28H26F3N5O7 |
| Molecular Weight | 601.54 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | N-[2-methoxy-4-[methyl-(2-morpholin-4-ylphenyl)carbamoyl]phenyl]-3-nitro-2-[(2,2,2-trifluoroacetyl)amino]benzamide |
| SMILES | COc1cc(C(=O)N(C)c2ccccc2N2CCOCC2)ccc1NC(=O)c1cccc([N+](=O)[O-])c1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C28H26F3N5O7/c1-34(20-7-3-4-8-21(20)35-12-14-43-15-13-35)26(38)17-10-11-19(23(16-17)42-2)32-25(37)18-6-5-9-22(36(40)41)24(18)33-27(39)28(29,30)31/h3-11,16H,12-15H2,1-2H3,(H,32,37)(H,33,39) |
| InChIKey | YONSYHAGRGNXSA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 143.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|