About ethanolate;(2-phenoxyphenyl)-triphenylphosphanium
ethanolate;(2-phenoxyphenyl)-triphenylphosphanium (PubChem CID 18356110) has the molecular formula C32H29O2P
and a molecular weight of 476.56 g/mol. Its IUPAC name is ethanolate;(2-phenoxyphenyl)-triphenylphosphanium.
Molecular Properties
| Compound Name | ethanolate;(2-phenoxyphenyl)-triphenylphosphanium |
| PubChem CID | 18356110 |
| Molecular Formula | C32H29O2P |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | ethanolate;(2-phenoxyphenyl)-triphenylphosphanium |
| SMILES | CC[O-].c1ccc(Oc2ccccc2[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24OP.C2H5O/c1-5-15-25(16-6-1)31-29-23-13-14-24-30(29)32(26-17-7-2-8-18-26,27-19-9-3-10-20-27)28-21-11-4-12-22-28;1-2-3/h1-24H;2H2,1H3/q+1;-1 |
| InChIKey | VUQYOLZZJIZOEZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethanolate;(2-phenoxyphenyl)-triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanolate;(2-phenoxyphenyl)-triphenylphosphanium?
The IUPAC name of ethanolate;(2-phenoxyphenyl)-triphenylphosphanium (CID 18356110) is ethanolate;(2-phenoxyphenyl)-triphenylphosphanium.
What is the SMILES notation for ethanolate;(2-phenoxyphenyl)-triphenylphosphanium?
The canonical SMILES for ethanolate;(2-phenoxyphenyl)-triphenylphosphanium is CC[O-].c1ccc(Oc2ccccc2[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of ethanolate;(2-phenoxyphenyl)-triphenylphosphanium?
The InChIKey is VUQYOLZZJIZOEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24OP.C2H5O/c1-5-15-25(16-6-1)31-29-23-13-14-24-30(29)32(26-17-7-2-8-18-26,27-19-9-3-10-20-27)28-21-11-4-12-22-28;1-2-3/h1-24H;2H2,1H3/q+1;-1.
What are the key properties of ethanolate;(2-phenoxyphenyl)-triphenylphosphanium?
ethanolate;(2-phenoxyphenyl)-triphenylphosphanium has a molecular weight of 476.56 g/mol, XLogP of 5.46, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanolate;(2-phenoxyphenyl)-triphenylphosphanium is sourced from PubChem (CID 18356110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).