About propane;propan-2-one
propane;propan-2-one (PubChem CID 18356450) has the molecular formula C6H14O
and a molecular weight of 102.18 g/mol. Its IUPAC name is propane;propan-2-one.
Molecular Properties
| Compound Name | propane;propan-2-one |
| PubChem CID | 18356450 |
| Molecular Formula | C6H14O |
| Molecular Weight | 102.18 g/mol |
| Exact Mass | 102.10 |
| IUPAC Name | propane;propan-2-one |
| SMILES | CC(C)=O.CCC |
| InChI | InChI=1S/C3H6O.C3H8/c1-3(2)4;1-3-2/h1-2H3;3H2,1-2H3 |
| InChIKey | NENJCPXKFYBJOW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.18 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propane;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;propan-2-one?
The IUPAC name of propane;propan-2-one (CID 18356450) is propane;propan-2-one.
What is the SMILES notation for propane;propan-2-one?
The canonical SMILES for propane;propan-2-one is CC(C)=O.CCC.
What is the InChIKey of propane;propan-2-one?
The InChIKey is NENJCPXKFYBJOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.C3H8/c1-3(2)4;1-3-2/h1-2H3;3H2,1-2H3.
What are the key properties of propane;propan-2-one?
propane;propan-2-one has a molecular weight of 102.18 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propane;propan-2-one is sourced from PubChem (CID 18356450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).