About 1-[2-([1,2]oxazolo[4,5-c]pyridin-3-yl)phenyl]but-3-en-1-amine
1-[2-([1,2]oxazolo[4,5-c]pyridin-3-yl)phenyl]but-3-en-1-amine (PubChem CID 18357523) has the molecular formula C16H15N3O
and a molecular weight of 265.32 g/mol. Its IUPAC name is 1-[2-([1,2]oxazolo[4,5-c]pyridin-3-yl)phenyl]but-3-en-1-amine.
Molecular Properties
| Compound Name | 1-[2-([1,2]oxazolo[4,5-c]pyridin-3-yl)phenyl]but-3-en-1-amine |
| PubChem CID | 18357523 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-[2-([1,2]oxazolo[4,5-c]pyridin-3-yl)phenyl]but-3-en-1-amine |
| SMILES | C=CCC(N)c1ccccc1-c1noc2ccncc12 |
| InChI | InChI=1S/C16H15N3O/c1-2-5-14(17)11-6-3-4-7-12(11)16-13-10-18-9-8-15(13)20-19-16/h2-4,6-10,14H,1,5,17H2 |
| InChIKey | XUSFQERTJLWRKN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-([1,2]oxazolo[4,5-c]pyridin-3-yl)phenyl]but-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-([1,2]oxazolo[4,5-c]pyridin-3-yl)phenyl]but-3-en-1-amine?
The IUPAC name of 1-[2-([1,2]oxazolo[4,5-c]pyridin-3-yl)phenyl]but-3-en-1-amine (CID 18357523) is 1-[2-([1,2]oxazolo[4,5-c]pyridin-3-yl)phenyl]but-3-en-1-amine.
What is the SMILES notation for 1-[2-([1,2]oxazolo[4,5-c]pyridin-3-yl)phenyl]but-3-en-1-amine?
The canonical SMILES for 1-[2-([1,2]oxazolo[4,5-c]pyridin-3-yl)phenyl]but-3-en-1-amine is C=CCC(N)c1ccccc1-c1noc2ccncc12.
What is the InChIKey of 1-[2-([1,2]oxazolo[4,5-c]pyridin-3-yl)phenyl]but-3-en-1-amine?
The InChIKey is XUSFQERTJLWRKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O/c1-2-5-14(17)11-6-3-4-7-12(11)16-13-10-18-9-8-15(13)20-19-16/h2-4,6-10,14H,1,5,17H2.
What are the key properties of 1-[2-([1,2]oxazolo[4,5-c]pyridin-3-yl)phenyl]but-3-en-1-amine?
1-[2-([1,2]oxazolo[4,5-c]pyridin-3-yl)phenyl]but-3-en-1-amine has a molecular weight of 265.32 g/mol, XLogP of 3.47, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-([1,2]oxazolo[4,5-c]pyridin-3-yl)phenyl]but-3-en-1-amine is sourced from PubChem (CID 18357523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).