About 2-(1,2-benzoxazol-3-yl)-5-chlorobenzaldehyde
2-(1,2-benzoxazol-3-yl)-5-chlorobenzaldehyde (PubChem CID 18357650) has the molecular formula C14H8ClNO2
and a molecular weight of 257.68 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-5-chlorobenzaldehyde.
Molecular Properties
| Compound Name | 2-(1,2-benzoxazol-3-yl)-5-chlorobenzaldehyde |
| PubChem CID | 18357650 |
| Molecular Formula | C14H8ClNO2 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-5-chlorobenzaldehyde |
| SMILES | O=Cc1cc(Cl)ccc1-c1noc2ccccc12 |
| InChI | InChI=1S/C14H8ClNO2/c15-10-5-6-11(9(7-10)8-17)14-12-3-1-2-4-13(12)18-16-14/h1-8H |
| InChIKey | TZXZGFVNRMFJSE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2-benzoxazol-3-yl)-5-chlorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-benzoxazol-3-yl)-5-chlorobenzaldehyde?
The IUPAC name of 2-(1,2-benzoxazol-3-yl)-5-chlorobenzaldehyde (CID 18357650) is 2-(1,2-benzoxazol-3-yl)-5-chlorobenzaldehyde.
What is the SMILES notation for 2-(1,2-benzoxazol-3-yl)-5-chlorobenzaldehyde?
The canonical SMILES for 2-(1,2-benzoxazol-3-yl)-5-chlorobenzaldehyde is O=Cc1cc(Cl)ccc1-c1noc2ccccc12.
What is the InChIKey of 2-(1,2-benzoxazol-3-yl)-5-chlorobenzaldehyde?
The InChIKey is TZXZGFVNRMFJSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8ClNO2/c15-10-5-6-11(9(7-10)8-17)14-12-3-1-2-4-13(12)18-16-14/h1-8H.
What are the key properties of 2-(1,2-benzoxazol-3-yl)-5-chlorobenzaldehyde?
2-(1,2-benzoxazol-3-yl)-5-chlorobenzaldehyde has a molecular weight of 257.68 g/mol, XLogP of 3.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-benzoxazol-3-yl)-5-chlorobenzaldehyde is sourced from PubChem (CID 18357650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).